C43H64 — CID 155642965
2-tert-butyl-1,3-bis[(1R)-1-(3,5-ditert-butylphenyl)ethyl]-5-methylbenzene (PubChem CID 155642965) has the molecular formula C43H64 and a molecular weight of 580.99 g/mol. Its IUPAC name is 2-tert-butyl-1,3-bis[(1R)-1-(3,5-ditert-butylphenyl)ethyl]-5-methylbenzene.
| Compound Name | 2-tert-butyl-1,3-bis[(1R)-1-(3,5-ditert-butylphenyl)ethyl]-5-methylbenzene |
|---|---|
| PubChem CID | 155642965 |
| Molecular Formula | C43H64 |
| Molecular Weight | 580.99 g/mol |
| Exact Mass | 580.50 |
| IUPAC Name | 2-tert-butyl-1,3-bis[(1R)-1-(3,5-ditert-butylphenyl)ethyl]-5-methylbenzene |
| SMILES | Cc1cc([C@H](C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(C(C)(C)C)c([C@H](C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C43H64/c1-27-19-36(28(2)30-21-32(39(4,5)6)25-33(22-30)40(7,8)9)38(43(16,17)18)37(20-27)29(3)31-23-34(41(10,11)12)26-35(24-31)42(13,14)15/h19-26,28-29H,1-18H3/t28-,29-/m1/s1 |
| InChIKey | BSJBFIVBIQYDPO-FQLXRVMXSA-N |
| XLogP | 12.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.99 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |