C59H53ClCuN2 — CID 155642969
7,9-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazol-8-ide;chlorocopper(1+) (PubChem CID 155642969) has the molecular formula C59H53ClCuN2 and a molecular weight of 889.09 g/mol. Its IUPAC name is 7,9-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazol-8-ide;chlorocopper(1+).
| Compound Name | 7,9-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazol-8-ide;chlorocopper(1+) |
|---|---|
| PubChem CID | 155642969 |
| Molecular Formula | C59H53ClCuN2 |
| Molecular Weight | 889.09 g/mol |
| Exact Mass | 887.32 |
| IUPAC Name | 7,9-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazol-8-ide;chlorocopper(1+) |
| SMILES | Cc1cc([C@H](C)c2ccccc2)c(N2[CH-]N(c3c([C@H](C)c4ccccc4)cc(C)cc3[C@H](C)c3ccccc3)C3=C2c2cccc4cccc3c24)c([C@H](C)c2ccccc2)c1.Cl[Cu+] |
| InChI | InChI=1S/C59H53N2.ClH.Cu/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47;;/h7-37,40-43H,1-6H3;1H;/q-1;;+2/p-1/t40-,41-,42-,43-;;/m1../s1 |
| InChIKey | BATPNMMGZSSJPG-OYSNOTGLSA-M |
| XLogP | 16.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.09 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|