C19H26BNO4 — CID 155644483
4-pent-4-enyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one (PubChem CID 155644483) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-pent-4-enyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 4-pent-4-enyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 155644483 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 4-pent-4-enyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-benzoxazin-3-one |
| SMILES | C=CCCCN1C(=O)COc2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C19H26BNO4/c1-6-7-8-11-21-15-12-14(9-10-16(15)23-13-17(21)22)20-24-18(2,3)19(4,5)25-20/h6,9-10,12H,1,7-8,11,13H2,2-5H3 |
| InChIKey | MDIONZZHJRKIND-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|