C18H33FN2 — CID 155644601
3-tert-butyl-2-[(3-fluorocyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazole (PubChem CID 155644601) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 3-tert-butyl-2-[(3-fluorocyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazole.
| Compound Name | 3-tert-butyl-2-[(3-fluorocyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazole |
|---|---|
| PubChem CID | 155644601 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 3-tert-butyl-2-[(3-fluorocyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazole |
| SMILES | CC(C)(C)N1C(CC2CCCC(F)C2)NC2CCCCC21 |
| InChI | InChI=1S/C18H33FN2/c1-18(2,3)21-16-10-5-4-9-15(16)20-17(21)12-13-7-6-8-14(19)11-13/h13-17,20H,4-12H2,1-3H3 |
| InChIKey | WUJQNPBSKRMQCA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |