About CID 155645247
CID 155645247 (PubChem CID 155645247) has the molecular formula C37H29F3IrN11-5
and a molecular weight of 876.93 g/mol.
Molecular Properties
| Compound Name | CID 155645247 |
| PubChem CID | 155645247 |
| Molecular Formula | C37H29F3IrN11-5 |
| Molecular Weight | 876.93 g/mol |
| Exact Mass | 877.22 |
| IUPAC Name | — |
| SMILES | CC(C)(c1cccc(-n2c3[c-]cncc3c3cnccc32)n1)c1cc(C(F)(F)F)n[n-]1.CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.[Ir] |
| InChI | InChI=1S/C22H15F3N6.C15H14N5.Ir/c1-21(2,18-10-19(30-29-18)22(23,24)25)17-4-3-5-20(28-17)31-15-6-8-26-11-13(15)14-12-27-9-7-16(14)31;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h3-6,8-12H,1-2H3;3-8,11-12H,1-2H3;/q-2;-3; |
| InChIKey | NWCUXAJGDRDYME-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 107.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.93 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155645247 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155645247?
The IUPAC name of CID 155645247 (CID 155645247) is not available.
What is the SMILES notation for CID 155645247?
The canonical SMILES for CID 155645247 is CC(C)(c1cccc(-n2c3[c-]cncc3c3cnccc32)n1)c1cc(C(F)(F)F)n[n-]1.CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.[Ir].
What is the InChIKey of CID 155645247?
The InChIKey is NWCUXAJGDRDYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N6.C15H14N5.Ir/c1-21(2,18-10-19(30-29-18)22(23,24)25)17-4-3-5-20(28-17)31-15-6-8-26-11-13(15)14-12-27-9-7-16(14)31;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h3-6,8-12H,1-2H3;3-8,11-12H,1-2H3;/q-2;-3;.
What are the key properties of CID 155645247?
CID 155645247 has a molecular weight of 876.93 g/mol, XLogP of 6.51, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155645247 is sourced from PubChem (CID 155645247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).