About CID 155645257
CID 155645257 (PubChem CID 155645257) has the molecular formula C36H29F3IrN11Si-5
and a molecular weight of 893.00 g/mol.
Molecular Properties
| Compound Name | CID 155645257 |
| PubChem CID | 155645257 |
| Molecular Formula | C36H29F3IrN11Si-5 |
| Molecular Weight | 893.00 g/mol |
| Exact Mass | 893.20 |
| IUPAC Name | — |
| SMILES | CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.C[Si](C)(c1cccc(-n2c3[c-]cncc3c3cnccc32)n1)c1cc(C(F)(F)F)n[n-]1.[Ir] |
| InChI | InChI=1S/C21H15F3N6Si.C15H14N5.Ir/c1-31(2,20-10-17(28-29-20)21(22,23)24)19-5-3-4-18(27-19)30-15-6-8-25-11-13(15)14-12-26-9-7-16(14)30;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h3-6,8-12H,1-2H3;3-8,11-12H,1-2H3;/q-2;-3; |
| InChIKey | GEXQAMMQKFAMHN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 107.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 893.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155645257 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155645257?
The IUPAC name of CID 155645257 (CID 155645257) is not available.
What is the SMILES notation for CID 155645257?
The canonical SMILES for CID 155645257 is CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.C[Si](C)(c1cccc(-n2c3[c-]cncc3c3cnccc32)n1)c1cc(C(F)(F)F)n[n-]1.[Ir].
What is the InChIKey of CID 155645257?
The InChIKey is GEXQAMMQKFAMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N6Si.C15H14N5.Ir/c1-31(2,20-10-17(28-29-20)21(22,23)24)19-5-3-4-18(27-19)30-15-6-8-25-11-13(15)14-12-26-9-7-16(14)30;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h3-6,8-12H,1-2H3;3-8,11-12H,1-2H3;/q-2;-3;.
What are the key properties of CID 155645257?
CID 155645257 has a molecular weight of 893.00 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155645257 is sourced from PubChem (CID 155645257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).