About CID 155645273
CID 155645273 (PubChem CID 155645273) has the molecular formula C43H34BF3IrN11-5
and a molecular weight of 964.84 g/mol.
Molecular Properties
| Compound Name | CID 155645273 |
| PubChem CID | 155645273 |
| Molecular Formula | C43H34BF3IrN11-5 |
| Molecular Weight | 964.84 g/mol |
| Exact Mass | 965.27 |
| IUPAC Name | — |
| SMILES | CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.Cc1cc(C)c(B(c2cccc(-n3c4[c-]cncc4c4cnccc43)n2)c2cc(C(F)(F)F)n[n-]2)c(C)c1.[Ir] |
| InChI | InChI=1S/C28H20BF3N6.C15H14N5.Ir/c1-16-11-17(2)27(18(3)12-16)29(25-13-23(36-37-25)28(30,31)32)24-5-4-6-26(35-24)38-21-7-9-33-14-19(21)20-15-34-10-8-22(20)38;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h4-7,9-15H,1-3H3;3-8,11-12H,1-2H3;/q-2;-3; |
| InChIKey | RYHXEADSRXLYCW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 107.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 964.84 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155645273 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155645273?
The IUPAC name of CID 155645273 (CID 155645273) is not available.
What is the SMILES notation for CID 155645273?
The canonical SMILES for CID 155645273 is CN1C=CN(c2[c-]c(N3C=CN(C)[CH-]3)cc(C#N)c2)[CH-]1.Cc1cc(C)c(B(c2cccc(-n3c4[c-]cncc4c4cnccc43)n2)c2cc(C(F)(F)F)n[n-]2)c(C)c1.[Ir].
What is the InChIKey of CID 155645273?
The InChIKey is RYHXEADSRXLYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20BF3N6.C15H14N5.Ir/c1-16-11-17(2)27(18(3)12-16)29(25-13-23(36-37-25)28(30,31)32)24-5-4-6-26(35-24)38-21-7-9-33-14-19(21)20-15-34-10-8-22(20)38;1-17-3-5-19(11-17)14-7-13(10-16)8-15(9-14)20-6-4-18(2)12-20;/h4-7,9-15H,1-3H3;3-8,11-12H,1-2H3;/q-2;-3;.
What are the key properties of CID 155645273?
CID 155645273 has a molecular weight of 964.84 g/mol, XLogP of 5.62, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155645273 is sourced from PubChem (CID 155645273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).