C36H19N3S — CID 155645624
2-(7-dibenzothiophen-2-ylbenzo[c]carbazol-10-yl)-3-isocyanobenzonitrile (PubChem CID 155645624) has the molecular formula C36H19N3S and a molecular weight of 525.64 g/mol. Its IUPAC name is 2-(7-dibenzothiophen-2-ylbenzo[c]carbazol-10-yl)-3-isocyanobenzonitrile.
| Compound Name | 2-(7-dibenzothiophen-2-ylbenzo[c]carbazol-10-yl)-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 155645624 |
| Molecular Formula | C36H19N3S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-(7-dibenzothiophen-2-ylbenzo[c]carbazol-10-yl)-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1ccc2c(c1)c1c3ccccc3ccc1n2-c1ccc2sc3ccccc3c2c1 |
| InChI | InChI=1S/C36H19N3S/c1-38-30-11-6-8-24(21-37)35(30)23-14-16-31-29(19-23)36-26-9-3-2-7-22(26)13-17-32(36)39(31)25-15-18-34-28(20-25)27-10-4-5-12-33(27)40-34/h2-20H |
| InChIKey | TZBPPFAJODWQDX-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 33.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|