C6H4F3NO2 — CID 155645805
(3Z)-3-(2,2,2-trifluoroethylidene)pyrrolidine-2,5-dione (PubChem CID 155645805) has the molecular formula C6H4F3NO2 and a molecular weight of 179.10 g/mol. Its IUPAC name is (3Z)-3-(2,2,2-trifluoroethylidene)pyrrolidine-2,5-dione.
| Compound Name | (3Z)-3-(2,2,2-trifluoroethylidene)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155645805 |
| Molecular Formula | C6H4F3NO2 |
| Molecular Weight | 179.10 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | (3Z)-3-(2,2,2-trifluoroethylidene)pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C/C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C6H4F3NO2/c7-6(8,9)2-3-1-4(11)10-5(3)12/h2H,1H2,(H,10,11,12)/b3-2- |
| InChIKey | QFLLBMRBTCKIMP-IHWYPQMZSA-N |
| XLogP | 0.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.10 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|