C36H33BO2 — CID 155645850
2-[7,10-bis(2-methylphenyl)fluoranthen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155645850) has the molecular formula C36H33BO2 and a molecular weight of 508.47 g/mol. Its IUPAC name is 2-[7,10-bis(2-methylphenyl)fluoranthen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7,10-bis(2-methylphenyl)fluoranthen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155645850 |
| Molecular Formula | C36H33BO2 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[7,10-bis(2-methylphenyl)fluoranthen-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccccc1-c1ccc(-c2ccccc2C)c2c1-c1cccc3c(B4OC(C)(C)C(C)(C)O4)ccc-2c13 |
| InChI | InChI=1S/C36H33BO2/c1-22-12-7-9-14-24(22)26-18-19-27(25-15-10-8-13-23(25)2)34-30-20-21-31(37-38-35(3,4)36(5,6)39-37)28-16-11-17-29(32(28)30)33(26)34/h7-21H,1-6H3 |
| InChIKey | CSGXORKIZYSFNN-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|