C30H20N6 — CID 15564616
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 15564616) has the molecular formula C30H20N6 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 15564616 |
| Molecular Formula | C30H20N6 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C30H20N6/c1-5-13-21(14-6-1)25-31-26(22-15-7-2-8-16-22)34-29(33-25)30-35-27(23-17-9-3-10-18-23)32-28(36-30)24-19-11-4-12-20-24/h1-20H |
| InChIKey | DXDNZINGLLBTEO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |