C16H12BrFIrN3- — CID 155646251
3-bromo-4-(2,6-dimethylphenyl)-5-(2-fluorobenzene-6-id-1-yl)-1,2,4-triazole;iridium (PubChem CID 155646251) has the molecular formula C16H12BrFIrN3- and a molecular weight of 537.41 g/mol. Its IUPAC name is 3-bromo-4-(2,6-dimethylphenyl)-5-(2-fluorobenzene-6-id-1-yl)-1,2,4-triazole;iridium.
| Compound Name | 3-bromo-4-(2,6-dimethylphenyl)-5-(2-fluorobenzene-6-id-1-yl)-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 155646251 |
| Molecular Formula | C16H12BrFIrN3- |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.98 |
| IUPAC Name | 3-bromo-4-(2,6-dimethylphenyl)-5-(2-fluorobenzene-6-id-1-yl)-1,2,4-triazole;iridium |
| SMILES | Cc1cccc(C)c1-n1c(Br)nnc1-c1[c-]cccc1F.[Ir] |
| InChI | InChI=1S/C16H12BrFN3.Ir/c1-10-6-5-7-11(2)14(10)21-15(19-20-16(21)17)12-8-3-4-9-13(12)18;/h3-7,9H,1-2H3;/q-1; |
| InChIKey | VYHDSTFVDAFBJF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|