C60H36N6 — CID 155647013
4-(3-isocyanophenyl)-2,5-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile (PubChem CID 155647013) has the molecular formula C60H36N6 and a molecular weight of 840.99 g/mol. Its IUPAC name is 4-(3-isocyanophenyl)-2,5-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-(3-isocyanophenyl)-2,5-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 155647013 |
| Molecular Formula | C60H36N6 |
| Molecular Weight | 840.99 g/mol |
| Exact Mass | 840.30 |
| IUPAC Name | 4-(3-isocyanophenyl)-2,5-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-n3c4ccccc4c4cc(-c5cccc(-c6ccccc6)n5)ccc43)c(C#N)cc2-n2c3ccccc3c3cc(-c4cccc(-c5ccccc5)n4)ccc32)c1 |
| InChI | InChI=1S/C60H36N6/c1-62-45-20-12-19-41(33-45)48-37-59(65-55-27-10-8-21-46(55)49-34-42(29-31-57(49)65)53-25-13-23-51(63-53)39-15-4-2-5-16-39)44(38-61)36-60(48)66-56-28-11-9-22-47(56)50-35-43(30-32-58(50)66)54-26-14-24-52(64-54)40-17-6-3-7-18-40/h2-37H |
| InChIKey | NNTTXBBWXSEMDF-UHFFFAOYSA-N |
| XLogP | 15.43 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.99 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|