C33H56N4O3 — CID 155647240
1-(4-methylpiperazin-1-yl)-3-[(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]urea (PubChem CID 155647240) has the molecular formula C33H56N4O3 and a molecular weight of 556.84 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-[(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]urea.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-[(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]urea |
|---|---|
| PubChem CID | 155647240 |
| Molecular Formula | C33H56N4O3 |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.44 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-[(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]urea |
| SMILES | C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5CC(NC(=O)NN6CCN(C)CC6)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C33H56N4O3/c1-21-8-13-33(39-20-21)22(2)29-28(40-33)19-27-25-7-6-23-18-24(34-30(38)35-37-16-14-36(5)15-17-37)9-11-31(23,3)26(25)10-12-32(27,29)4/h21-29H,6-20H2,1-5H3,(H2,34,35,38)/t21-,22-,23+,24?,25+,26-,27-,28-,29-,31-,32-,33+/m0/s1 |
| InChIKey | NMTLLAGQARSEEU-SZIXXFSKSA-N |
| XLogP | 5.26 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |