C8H17O7P — CID 155647582
3,4,5,6,7-pentahydroxy-1-phosphanyloxyoctan-2-one (PubChem CID 155647582) has the molecular formula C8H17O7P and a molecular weight of 256.19 g/mol. Its IUPAC name is 3,4,5,6,7-pentahydroxy-1-phosphanyloxyoctan-2-one.
| Compound Name | 3,4,5,6,7-pentahydroxy-1-phosphanyloxyoctan-2-one |
|---|---|
| PubChem CID | 155647582 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3,4,5,6,7-pentahydroxy-1-phosphanyloxyoctan-2-one |
| SMILES | CC(O)C(O)C(O)C(O)C(O)C(=O)COP |
| InChI | InChI=1S/C8H17O7P/c1-3(9)5(11)7(13)8(14)6(12)4(10)2-15-16/h3,5-9,11-14H,2,16H2,1H3 |
| InChIKey | OXQVULHSMIQJEA-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|