C22H22N4O14S4 — CID 155647958
2-[4-[[2,4-dihydroxy-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 155647958) has the molecular formula C22H22N4O14S4 and a molecular weight of 694.70 g/mol. Its IUPAC name is 2-[4-[[2,4-dihydroxy-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[2,4-dihydroxy-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 155647958 |
| Molecular Formula | C22H22N4O14S4 |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 694.00 |
| IUPAC Name | 2-[4-[[2,4-dihydroxy-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1ccc(/N=N/c2cc(/N=N/c3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3)c(O)cc2O)cc1 |
| InChI | InChI=1S/C22H22N4O14S4/c27-21-14-22(28)20(26-24-16-3-7-18(8-4-16)42(31,32)12-10-40-44(36,37)38)13-19(21)25-23-15-1-5-17(6-2-15)41(29,30)11-9-39-43(33,34)35/h1-8,13-14,27-28H,9-12H2,(H,33,34,35)(H,36,37,38)/b25-23+,26-24+ |
| InChIKey | BXFYAYUDTXWHJB-OGGGYYITSA-N |
| XLogP | 3.11 |
| TPSA | 285.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|