C4ClF7O — CID 15564851
3-chloro-1,1,1,3,4,4,4-heptafluorobutan-2-one (PubChem CID 15564851) has the molecular formula C4ClF7O and a molecular weight of 232.48 g/mol. Its IUPAC name is 3-chloro-1,1,1,3,4,4,4-heptafluorobutan-2-one.
| Compound Name | 3-chloro-1,1,1,3,4,4,4-heptafluorobutan-2-one |
|---|---|
| PubChem CID | 15564851 |
| Molecular Formula | C4ClF7O |
| Molecular Weight | 232.48 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 3-chloro-1,1,1,3,4,4,4-heptafluorobutan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C4ClF7O/c5-2(6,4(10,11)12)1(13)3(7,8)9 |
| InChIKey | BEFHMDTXHPSQEI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|