C6H14FNO8P2-2 — CID 155648991
2-[[3-(fluoroamino)-2-methylpropoxy]-oxidophosphoryl]oxyethyl hydrogen phosphate (PubChem CID 155648991) has the molecular formula C6H14FNO8P2-2 and a molecular weight of 309.12 g/mol. Its IUPAC name is 2-[[3-(fluoroamino)-2-methylpropoxy]-oxidophosphoryl]oxyethyl hydrogen phosphate.
| Compound Name | 2-[[3-(fluoroamino)-2-methylpropoxy]-oxidophosphoryl]oxyethyl hydrogen phosphate |
|---|---|
| PubChem CID | 155648991 |
| Molecular Formula | C6H14FNO8P2-2 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[[3-(fluoroamino)-2-methylpropoxy]-oxidophosphoryl]oxyethyl hydrogen phosphate |
| SMILES | CC(CNF)COP(=O)([O-])OCCOP(=O)([O-])O |
| InChI | InChI=1S/C6H16FNO8P2/c1-6(4-8-7)5-16-18(12,13)15-3-2-14-17(9,10)11/h6,8H,2-5H2,1H3,(H,12,13)(H2,9,10,11)/p-2 |
| InChIKey | TYMQTLDEGORFOI-UHFFFAOYSA-L |
| XLogP | -0.92 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|