C20H28N2O3 — CID 155649138
N-ethyl-2-hydroxy-2-[(4S,6Z)-2-oxo-3-azabicyclo[11.4.0]heptadeca-1(17),6,13,15-tetraen-4-yl]acetamide (PubChem CID 155649138) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-ethyl-2-hydroxy-2-[(4S,6Z)-2-oxo-3-azabicyclo[11.4.0]heptadeca-1(17),6,13,15-tetraen-4-yl]acetamide.
| Compound Name | N-ethyl-2-hydroxy-2-[(4S,6Z)-2-oxo-3-azabicyclo[11.4.0]heptadeca-1(17),6,13,15-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 155649138 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-ethyl-2-hydroxy-2-[(4S,6Z)-2-oxo-3-azabicyclo[11.4.0]heptadeca-1(17),6,13,15-tetraen-4-yl]acetamide |
| SMILES | CCNC(=O)C(O)[C@@H]1C/C=C\CCCCCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-21-20(25)18(23)17-14-8-6-4-3-5-7-11-15-12-9-10-13-16(15)19(24)22-17/h6,8-10,12-13,17-18,23H,2-5,7,11,14H2,1H3,(H,21,25)(H,22,24)/b8-6-/t17-,18?/m0/s1 |
| InChIKey | MGHQFNVTKYLGJG-RHZZENSISA-N |
| XLogP | 2.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|