C11H21NO — CID 155649452
4,5-ditert-butyl-2,3-dihydro-1,3-oxazole (PubChem CID 155649452) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,3-dihydro-1,3-oxazole.
| Compound Name | 4,5-ditert-butyl-2,3-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 155649452 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4,5-ditert-butyl-2,3-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)OCN1 |
| InChI | InChI=1S/C11H21NO/c1-10(2,3)8-9(11(4,5)6)13-7-12-8/h12H,7H2,1-6H3 |
| InChIKey | CULDFCANRMUIFS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |