About CID 155649992
CID 155649992 (PubChem CID 155649992) has the molecular formula C38H31N3O2PtS
and a molecular weight of 788.83 g/mol.
Molecular Properties
| Compound Name | CID 155649992 |
| PubChem CID | 155649992 |
| Molecular Formula | C38H31N3O2PtS |
| Molecular Weight | 788.83 g/mol |
| Exact Mass | 788.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)oc4sc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C38H31N3O2S.Pt/c1-37(2,3)22-15-16-39-33(18-22)41-29-10-8-7-9-26(29)27-13-11-25(20-30(27)41)42-24-12-14-31-28(19-24)34-35-32(44-36(34)43-31)17-23(21-40-35)38(4,5)6;/h7-18,21H,1-6H3;/q-2;+2 |
| InChIKey | ZILHOONKSWLXGK-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 788.83 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155649992 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155649992?
The IUPAC name of CID 155649992 (CID 155649992) is not available.
What is the SMILES notation for CID 155649992?
The canonical SMILES for CID 155649992 is CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)oc4sc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)c1.[Pt+2].
What is the InChIKey of CID 155649992?
The InChIKey is ZILHOONKSWLXGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H31N3O2S.Pt/c1-37(2,3)22-15-16-39-33(18-22)41-29-10-8-7-9-26(29)27-13-11-25(20-30(27)41)42-24-12-14-31-28(19-24)34-35-32(44-36(34)43-31)17-23(21-40-35)38(4,5)6;/h7-18,21H,1-6H3;/q-2;+2.
What are the key properties of CID 155649992?
CID 155649992 has a molecular weight of 788.83 g/mol, XLogP of 10.67, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155649992 is sourced from PubChem (CID 155649992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).