About CID 155649997
CID 155649997 (PubChem CID 155649997) has the molecular formula C36H27N3O2PtS
and a molecular weight of 760.78 g/mol.
Molecular Properties
| Compound Name | CID 155649997 |
| PubChem CID | 155649997 |
| Molecular Formula | C36H27N3O2PtS |
| Molecular Weight | 760.78 g/mol |
| Exact Mass | 760.15 |
| IUPAC Name | — |
| SMILES | Cc1cnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)oc4sc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)cc1C.[Pt+2] |
| InChI | InChI=1S/C36H27N3O2S.Pt/c1-20-14-32(37-18-21(20)2)39-28-9-7-6-8-25(28)26-12-10-24(17-29(26)39)40-23-11-13-30-27(16-23)33-34-31(42-35(33)41-30)15-22(19-38-34)36(3,4)5;/h6-15,18-19H,1-5H3;/q-2;+2 |
| InChIKey | OPAFJYCWSXBLHP-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.78 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155649997 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155649997?
The IUPAC name of CID 155649997 (CID 155649997) is not available.
What is the SMILES notation for CID 155649997?
The canonical SMILES for CID 155649997 is Cc1cnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)oc4sc6cc(C(C)(C)C)cnc6c45)ccc3c3ccccc32)cc1C.[Pt+2].
What is the InChIKey of CID 155649997?
The InChIKey is OPAFJYCWSXBLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27N3O2S.Pt/c1-20-14-32(37-18-21(20)2)39-28-9-7-6-8-25(28)26-12-10-24(17-29(26)39)40-23-11-13-30-27(16-23)33-34-31(42-35(33)41-30)15-22(19-38-34)36(3,4)5;/h6-15,18-19H,1-5H3;/q-2;+2.
What are the key properties of CID 155649997?
CID 155649997 has a molecular weight of 760.78 g/mol, XLogP of 9.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155649997 is sourced from PubChem (CID 155649997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).