C56H52N4Si — CID 155651075
[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenylsilane (PubChem CID 155651075) has the molecular formula C56H52N4Si and a molecular weight of 809.15 g/mol. Its IUPAC name is [3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenylsilane.
| Compound Name | [3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenylsilane |
|---|---|
| PubChem CID | 155651075 |
| Molecular Formula | C56H52N4Si |
| Molecular Weight | 809.15 g/mol |
| Exact Mass | 808.40 |
| IUPAC Name | [3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenylsilane |
| SMILES | CC(C)(C)c1cccc(N2CN(c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C56H52N4Si/c1-55(2,3)40-19-17-20-42(35-40)58-39-59(52-30-16-15-29-51(52)58)43-21-18-26-46(37-43)61(44-22-9-7-10-23-44,45-24-11-8-12-25-45)47-31-32-49-48-27-13-14-28-50(48)60(53(49)38-47)54-36-41(33-34-57-54)56(4,5)6/h7-38H,39H2,1-6H3 |
| InChIKey | OIQWBCDJAUWKJV-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.15 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|