C6H10O3 — CID 15565117
(4R)-4-hydroxy-5,5-dimethyloxolan-2-one (PubChem CID 15565117) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (4R)-4-hydroxy-5,5-dimethyloxolan-2-one.
| Compound Name | (4R)-4-hydroxy-5,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 15565117 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4R)-4-hydroxy-5,5-dimethyloxolan-2-one |
| SMILES | CC1(C)OC(=O)C[C@H]1O |
| InChI | InChI=1S/C6H10O3/c1-6(2)4(7)3-5(8)9-6/h4,7H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | SIEVQTNTRMBCHO-SCSAIBSYSA-N |
| XLogP | 0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |