C51H48N5+ — CID 155651850
[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenyl-[3-[3-(2,4,5-trimethylphenyl)-2H-imidazol-1-yl]phenyl]azanium (PubChem CID 155651850) has the molecular formula C51H48N5+ and a molecular weight of 730.98 g/mol. Its IUPAC name is [9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenyl-[3-[3-(2,4,5-trimethylphenyl)-2H-imidazol-1-yl]phenyl]azanium.
| Compound Name | [9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenyl-[3-[3-(2,4,5-trimethylphenyl)-2H-imidazol-1-yl]phenyl]azanium |
|---|---|
| PubChem CID | 155651850 |
| Molecular Formula | C51H48N5+ |
| Molecular Weight | 730.98 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | [9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]-diphenyl-[3-[3-(2,4,5-trimethylphenyl)-2H-imidazol-1-yl]phenyl]azanium |
| SMILES | Cc1cc(C)c(N2C=CN(c3cccc([N+](c4ccccc4)(c4ccccc4)c4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)C2)cc1C |
| InChI | InChI=1S/C51H48N5/c1-36-30-38(3)48(31-37(36)2)54-29-28-53(35-54)40-16-15-21-43(33-40)56(41-17-9-7-10-18-41,42-19-11-8-12-20-42)44-24-25-46-45-22-13-14-23-47(45)55(49(46)34-44)50-32-39(26-27-52-50)51(4,5)6/h7-34H,35H2,1-6H3/q+1 |
| InChIKey | ZEWSOLZDKOXIID-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.98 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|