C10H10N2O2 — CID 155652897
3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a][1,5]naphthyridin-1-one (PubChem CID 155652897) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a][1,5]naphthyridin-1-one.
| Compound Name | 3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a][1,5]naphthyridin-1-one |
|---|---|
| PubChem CID | 155652897 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a][1,5]naphthyridin-1-one |
| SMILES | O=C1OCC2CCc3ncccc3N12 |
| InChI | InChI=1S/C10H10N2O2/c13-10-12-7(6-14-10)3-4-8-9(12)2-1-5-11-8/h1-2,5,7H,3-4,6H2 |
| InChIKey | ZTOUQQFLFVGBMS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |