C32H14N4O — CID 155653938
7-isocyano-3-(11-oxahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)quinoxaline-6-carbonitrile (PubChem CID 155653938) has the molecular formula C32H14N4O and a molecular weight of 470.49 g/mol. Its IUPAC name is 7-isocyano-3-(11-oxahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)quinoxaline-6-carbonitrile.
| Compound Name | 7-isocyano-3-(11-oxahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 155653938 |
| Molecular Formula | C32H14N4O |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 7-isocyano-3-(11-oxahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)quinoxaline-6-carbonitrile |
| SMILES | [C-]#[N+]c1cc2ncc(-c3c4c(cc5oc6ccccc6c35)-c3cccc5cccc-4c35)nc2cc1C#N |
| InChI | InChI=1S/C32H14N4O/c1-34-23-14-24-25(12-18(23)15-33)36-26(16-35-24)32-30-21-10-5-7-17-6-4-9-19(29(17)21)22(30)13-28-31(32)20-8-2-3-11-27(20)37-28/h2-14,16H |
| InChIKey | JHCHFCQZPAFRDK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 67.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|