C83H49F3N8 — CID 155654175
3-[2,4-bis[2,7-bis(2-phenyl-3-pyridinyl)carbazol-9-yl]-3-isocyanophenyl]-5-(trifluoromethyl)benzonitrile (PubChem CID 155654175) has the molecular formula C83H49F3N8 and a molecular weight of 1215.36 g/mol. Its IUPAC name is 3-[2,4-bis[2,7-bis(2-phenyl-3-pyridinyl)carbazol-9-yl]-3-isocyanophenyl]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[2,4-bis[2,7-bis(2-phenyl-3-pyridinyl)carbazol-9-yl]-3-isocyanophenyl]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 155654175 |
| Molecular Formula | C83H49F3N8 |
| Molecular Weight | 1215.36 g/mol |
| Exact Mass | 1214.40 |
| IUPAC Name | 3-[2,4-bis[2,7-bis(2-phenyl-3-pyridinyl)carbazol-9-yl]-3-isocyanophenyl]-5-(trifluoromethyl)benzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3cc(-c4cccnc4-c4ccccc4)ccc3c3ccc(-c4cccnc4-c4ccccc4)cc32)ccc(-c2cc(C#N)cc(C(F)(F)F)c2)c1-n1c2cc(-c3cccnc3-c3ccccc3)ccc2c2ccc(-c3cccnc3-c3ccccc3)cc21 |
| InChI | InChI=1S/C83H49F3N8/c1-88-81-72(93-73-47-57(63-26-14-40-89-77(63)53-18-6-2-7-19-53)30-34-68(73)69-35-31-58(48-74(69)93)64-27-15-41-90-78(64)54-20-8-3-9-21-54)39-38-67(61-44-52(51-87)45-62(46-61)83(84,85)86)82(81)94-75-49-59(65-28-16-42-91-79(65)55-22-10-4-11-23-55)32-36-70(75)71-37-33-60(50-76(71)94)66-29-17-43-92-80(66)56-24-12-5-13-25-56/h2-50H |
| InChIKey | PCEFHQVCXOEZPP-UHFFFAOYSA-N |
| XLogP | 21.91 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.36 |
| LogP ≤ 5 | 21.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|