About 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile (PubChem CID 155654740) has the molecular formula C14H18F3NOSi
and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile |
| PubChem CID | 155654740 |
| Molecular Formula | C14H18F3NOSi |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(F)c(C#N)c(F)c1F |
| InChI | InChI=1S/C14H18F3NOSi/c1-14(2,3)20(4,5)19-8-9-6-11(15)10(7-18)13(17)12(9)16/h6H,8H2,1-5H3 |
| InChIKey | XPHDPOOVHLXCHG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile?
The IUPAC name of 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile (CID 155654740) is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile.
What is the SMILES notation for 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile?
The canonical SMILES for 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile is CC(C)(C)[Si](C)(C)OCc1cc(F)c(C#N)c(F)c1F.
What is the InChIKey of 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile?
The InChIKey is XPHDPOOVHLXCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3NOSi/c1-14(2,3)20(4,5)19-8-9-6-11(15)10(7-18)13(17)12(9)16/h6H,8H2,1-5H3.
What are the key properties of 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile?
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile has a molecular weight of 301.38 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile is sourced from PubChem (CID 155654740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).