C14H18F3NOSi — CID 155654740
4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile (PubChem CID 155654740) has the molecular formula C14H18F3NOSi and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 155654740 |
| Molecular Formula | C14H18F3NOSi |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6-trifluorobenzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(F)c(C#N)c(F)c1F |
| InChI | InChI=1S/C14H18F3NOSi/c1-14(2,3)20(4,5)19-8-9-6-11(15)10(7-18)13(17)12(9)16/h6H,8H2,1-5H3 |
| InChIKey | XPHDPOOVHLXCHG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|