C12H16FN2O3+ — CID 155655107
[1-carboxy-4-[2-(fluoromethyl)anilino]-4-oxobutyl]azanium (PubChem CID 155655107) has the molecular formula C12H16FN2O3+ and a molecular weight of 255.27 g/mol. Its IUPAC name is [1-carboxy-4-[2-(fluoromethyl)anilino]-4-oxobutyl]azanium.
| Compound Name | [1-carboxy-4-[2-(fluoromethyl)anilino]-4-oxobutyl]azanium |
|---|---|
| PubChem CID | 155655107 |
| Molecular Formula | C12H16FN2O3+ |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | [1-carboxy-4-[2-(fluoromethyl)anilino]-4-oxobutyl]azanium |
| SMILES | [NH3+]C(CCC(=O)Nc1ccccc1CF)C(=O)O |
| InChI | InChI=1S/C12H15FN2O3/c13-7-8-3-1-2-4-10(8)15-11(16)6-5-9(14)12(17)18/h1-4,9H,5-7,14H2,(H,15,16)(H,17,18)/p+1 |
| InChIKey | QKUXQMURWWKBHT-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |