C74H54N2O2S2Si2 — CID 155655459
CID 155655459 (PubChem CID 155655459) has the molecular formula C74H54N2O2S2Si2 and a molecular weight of 1123.56 g/mol.
| Compound Name | CID 155655459 |
|---|---|
| PubChem CID | 155655459 |
| Molecular Formula | C74H54N2O2S2Si2 |
| Molecular Weight | 1123.56 g/mol |
| Exact Mass | 1122.32 |
| IUPAC Name | — |
| SMILES | C[Si]1(C)c2ccccc2C2(c3ccccc31)c1cc(N(c3ccccc3)c3ccc4c(c3)oc3ccccc34)sc1C1(c3ccccc3[Si](C)(C)c3ccccc31)c1cc(N(c3ccccc3)c3ccc4c(c3)oc3ccccc34)sc12 |
| InChI | InChI=1S/C74H54N2O2S2Si2/c1-81(2)65-35-19-13-29-55(65)73(56-30-14-20-36-66(56)81)59-45-69(75(47-23-7-5-8-24-47)49-39-41-53-51-27-11-17-33-61(51)77-63(53)43-49)80-72(59)74(57-31-15-21-37-67(57)82(3,4)68-38-22-16-32-58(68)74)60-46-70(79-71(60)73)76(48-25-9-6-10-26-48)50-40-42-54-52-28-12-18-34-62(52)78-64(54)44-50/h5-46H,1-4H3 |
| InChIKey | FRGCEZGGUHWLBH-UHFFFAOYSA-N |
| XLogP | 17.90 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1123.56 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|