About 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol
3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol (PubChem CID 155655652) has the molecular formula C22H33NO
and a molecular weight of 327.51 g/mol. Its IUPAC name is 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol |
| PubChem CID | 155655652 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol |
| SMILES | CC1(C)C2C[C@@H]1CCC2CNC1CC(O)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H33NO/c1-22(2)18-9-8-16(21(22)12-18)14-23-19-10-17(11-20(24)13-19)15-6-4-3-5-7-15/h3-7,16-21,23-24H,8-14H2,1-2H3/t16?,17?,18-,19?,20?,21?/m0/s1 |
| InChIKey | QHAJAFWAGNBEGJ-VRIWYIIQSA-N |
| XLogP | 4.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol?
The IUPAC name of 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol (CID 155655652) is 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol.
What is the SMILES notation for 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol?
The canonical SMILES for 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol is CC1(C)C2C[C@@H]1CCC2CNC1CC(O)CC(c2ccccc2)C1.
What is the InChIKey of 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol?
The InChIKey is QHAJAFWAGNBEGJ-VRIWYIIQSA-N. The full InChI is InChI=1S/C22H33NO/c1-22(2)18-9-8-16(21(22)12-18)14-23-19-10-17(11-20(24)13-19)15-6-4-3-5-7-15/h3-7,16-21,23-24H,8-14H2,1-2H3/t16?,17?,18-,19?,20?,21?/m0/s1.
What are the key properties of 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol?
3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol has a molecular weight of 327.51 g/mol, XLogP of 4.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]-5-phenylcyclohexan-1-ol is sourced from PubChem (CID 155655652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).