C32H24BrFN6O3 — CID 155655959
4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-fluorophenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 155655959) has the molecular formula C32H24BrFN6O3 and a molecular weight of 639.49 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-fluorophenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-fluorophenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155655959 |
| Molecular Formula | C32H24BrFN6O3 |
| Molecular Weight | 639.49 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-fluorophenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1cc(C(=O)N2CCc3c(n4ncc(Cc5ccc(F)cc5)c4n(-c4ccc(C(=O)NC)cc4)c3=O)C2)ccc1Br |
| InChI | InChI=1S/C32H24BrFN6O3/c1-35-27-16-21(7-12-26(27)33)31(42)38-14-13-25-28(18-38)40-30(22(17-37-40)15-19-3-8-23(34)9-4-19)39(32(25)43)24-10-5-20(6-11-24)29(41)36-2/h3-12,16-17H,13-15,18H2,2H3,(H,36,41) |
| InChIKey | KYJIYTWFNFYVCR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|