C18H11BO — CID 155656323
CID 155656323 (PubChem CID 155656323) has the molecular formula C18H11BO and a molecular weight of 254.10 g/mol.
| Compound Name | CID 155656323 |
|---|---|
| PubChem CID | 155656323 |
| Molecular Formula | C18H11BO |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)oc1cccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H11BO/c19-13-9-10-15-17(11-13)20-16-8-4-7-14(18(15)16)12-5-2-1-3-6-12/h1-11H |
| InChIKey | GFVJPNTZCMOJSK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|