About N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium
N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium (PubChem CID 155657078) has the molecular formula C10H17NY-2
and a molecular weight of 240.16 g/mol. Its IUPAC name is N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium.
Molecular Properties
| Compound Name | N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium |
| PubChem CID | 155657078 |
| Molecular Formula | C10H17NY-2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium |
| SMILES | [H]/[C-]=C(/N=[C-]/C(C)C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C10H17N.Y/c1-8(2)7-11-9(3)10(4,5)6;/h3,8H,1-2,4-6H3;/q-2; |
| InChIKey | PBLIGJDSIVOMIE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium?
The IUPAC name of N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium (CID 155657078) is N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium.
What is the SMILES notation for N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium?
The canonical SMILES for N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium is [H]/[C-]=C(/N=[C-]/C(C)C)C(C)(C)C.[Y].
What is the InChIKey of N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium?
The InChIKey is PBLIGJDSIVOMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.Y/c1-8(2)7-11-9(3)10(4,5)6;/h3,8H,1-2,4-6H3;/q-2;.
What are the key properties of N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium?
N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium has a molecular weight of 240.16 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbut-1-en-2-yl)-2-methylpropan-1-imine;yttrium is sourced from PubChem (CID 155657078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).