C13H15F4O5S- — CID 155657111
3-(1-adamantyloxy)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonate (PubChem CID 155657111) has the molecular formula C13H15F4O5S- and a molecular weight of 359.32 g/mol. Its IUPAC name is 3-(1-adamantyloxy)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonate.
| Compound Name | 3-(1-adamantyloxy)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 155657111 |
| Molecular Formula | C13H15F4O5S- |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-(1-adamantyloxy)-1,1,2,2-tetrafluoro-3-oxopropane-1-sulfonate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H16F4O5S/c14-12(15,13(16,17)23(19,20)21)10(18)22-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,19,20,21)/p-1 |
| InChIKey | QBMPOXDSQFBMAK-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|