C20H18F2N2O4S — CID 155658180
(3S)-4-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]-3-phenylbutanethioic S-acid (PubChem CID 155658180) has the molecular formula C20H18F2N2O4S and a molecular weight of 420.44 g/mol. Its IUPAC name is (3S)-4-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]-3-phenylbutanethioic S-acid.
| Compound Name | (3S)-4-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]-3-phenylbutanethioic S-acid |
|---|---|
| PubChem CID | 155658180 |
| Molecular Formula | C20H18F2N2O4S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (3S)-4-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]-3-phenylbutanethioic S-acid |
| SMILES | O=C(S)CC(CNc1noc2c(F)c(F)c(C3OCCO3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H18F2N2O4S/c21-16-13(20-26-6-7-27-20)9-14-18(17(16)22)28-24-19(14)23-10-12(8-15(25)29)11-4-2-1-3-5-11/h1-5,9,12,20H,6-8,10H2,(H,23,24)(H,25,29) |
| InChIKey | IINUHUQOFZEGON-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|