C27H34B2F5NO9S2 — CID 155660139
2-[[3-[3-(pentafluoro-λ6-sulfanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetic acid (PubChem CID 155660139) has the molecular formula C27H34B2F5NO9S2 and a molecular weight of 697.32 g/mol. Its IUPAC name is 2-[[3-[3-(pentafluoro-λ6-sulfanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-[3-(pentafluoro-λ6-sulfanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 155660139 |
| Molecular Formula | C27H34B2F5NO9S2 |
| Molecular Weight | 697.32 g/mol |
| Exact Mass | 697.18 |
| IUPAC Name | 2-[[3-[3-(pentafluoro-λ6-sulfanyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]acetic acid |
| SMILES | CC1(C)OB(c2cc(C(=O)NCC(=O)O)cc(S(=O)(=O)c3cc(B4OC(C)(C)C(C)(C)O4)cc(S(F)(F)(F)(F)F)c3)c2)OC1(C)C |
| InChI | InChI=1S/C27H34B2F5NO9S2/c1-24(2)25(3,4)42-28(41-24)17-9-16(23(38)35-15-22(36)37)10-19(11-17)45(39,40)20-12-18(13-21(14-20)46(30,31,32,33)34)29-43-26(5,6)27(7,8)44-29/h9-14H,15H2,1-8H3,(H,35,38)(H,36,37) |
| InChIKey | IVYFPXWKPGUUBC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|