C30H38B2F2O7 — CID 155660171
tert-butyl 3-[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 155660171) has the molecular formula C30H38B2F2O7 and a molecular weight of 570.25 g/mol. Its IUPAC name is tert-butyl 3-[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | tert-butyl 3-[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 155660171 |
| Molecular Formula | C30H38B2F2O7 |
| Molecular Weight | 570.25 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | tert-butyl 3-[2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)c2cc(B3OC(C)(C)C(C)(C)O3)c(F)cc2F)c1 |
| InChI | InChI=1S/C30H38B2F2O7/c1-26(2,3)37-25(36)18-12-17(13-19(14-18)31-38-27(4,5)28(6,7)39-31)24(35)20-15-21(23(34)16-22(20)33)32-40-29(8,9)30(10,11)41-32/h12-16H,1-11H3 |
| InChIKey | JMJSQXFFPXJZPP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|