C16H25N7O2S2 — CID 15566026
1-N,1-N'-bis[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 15566026) has the molecular formula C16H25N7O2S2 and a molecular weight of 411.56 g/mol. Its IUPAC name is 1-N,1-N'-bis[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 15566026 |
| Molecular Formula | C16H25N7O2S2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-N,1-N'-bis[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | Cc1[nH]cnc1CSCCNC(=C[N+](=O)[O-])NCCSCc1nc[nH]c1C |
| InChI | InChI=1S/C16H25N7O2S2/c1-12-14(21-10-19-12)8-26-5-3-17-16(7-23(24)25)18-4-6-27-9-15-13(2)20-11-22-15/h7,10-11,17-18H,3-6,8-9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | SFBOFXWBLWSFSM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|