C15H22N2O3 — CID 155660843
(3S)-3-(oxan-2-ylmethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine (PubChem CID 155660843) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3S)-3-(oxan-2-ylmethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine.
| Compound Name | (3S)-3-(oxan-2-ylmethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine |
|---|---|
| PubChem CID | 155660843 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (3S)-3-(oxan-2-ylmethoxy)-2,3,4,5-tetrahydro-1,5-benzoxazepin-7-amine |
| SMILES | Nc1ccc2c(c1)NC[C@H](OCC1CCCCO1)CO2 |
| InChI | InChI=1S/C15H22N2O3/c16-11-4-5-15-14(7-11)17-8-13(10-20-15)19-9-12-3-1-2-6-18-12/h4-5,7,12-13,17H,1-3,6,8-10,16H2/t12?,13-/m0/s1 |
| InChIKey | IBFJCAZGAZKXBG-ABLWVSNPSA-N |
| XLogP | 2.03 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|