C19H18Cl4O — CID 155660928
3-[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 155660928) has the molecular formula C19H18Cl4O and a molecular weight of 404.16 g/mol. Its IUPAC name is 3-[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 3-[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 155660928 |
| Molecular Formula | C19H18Cl4O |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 3-[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CC(=O)C(C)=C(C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)C1 |
| InChI | InChI=1S/C19H18Cl4O/c1-9(2)11-6-15(10(3)16(24)7-11)18-17(19(18,22)23)12-4-13(20)8-14(21)5-12/h4-5,8,11,17-18H,1,6-7H2,2-3H3 |
| InChIKey | HEQVRRMLHNLLEL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|