C10H9NO3 — CID 155661312
N-(2-acetyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide (PubChem CID 155661312) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is N-(2-acetyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide.
| Compound Name | N-(2-acetyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 155661312 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N-(2-acetyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1\C=CC(=O)C=C1C(C)=O |
| InChI | InChI=1S/C10H9NO3/c1-6(12)9-5-8(14)3-4-10(9)11-7(2)13/h3-5H,1-2H3/b11-10+ |
| InChIKey | JFQCPWYBZHRXAK-ZHACJKMWSA-N |
| XLogP | 0.63 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|