C38H39F5N4O4S — CID 155662179
(2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[4-[(dimethylamino)methyl]-3-phenylmethoxyphenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide (PubChem CID 155662179) has the molecular formula C38H39F5N4O4S and a molecular weight of 742.81 g/mol. Its IUPAC name is (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[4-[(dimethylamino)methyl]-3-phenylmethoxyphenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide.
| Compound Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[4-[(dimethylamino)methyl]-3-phenylmethoxyphenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 155662179 |
| Molecular Formula | C38H39F5N4O4S |
| Molecular Weight | 742.81 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | (2R)-N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-[4-[(dimethylamino)methyl]-3-phenylmethoxyphenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carboxamide |
| SMILES | CN(C)Cc1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C38H39F5N4O4S/c1-45(2)21-27-14-16-29(19-31(27)51-23-24-9-5-3-6-10-24)46(22-28-15-13-26(20-44-28)25-11-7-4-8-12-25)38(48)30-17-18-47(30)52(49,50)37-35(42)33(40)32(39)34(41)36(37)43/h3,5-6,9-10,13-16,19-20,25,30H,4,7-8,11-12,17-18,21-23H2,1-2H3/t30-/m1/s1 |
| InChIKey | DZIXHPQHNLBNOQ-SSEXGKCCSA-N |
| XLogP | 7.46 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.81 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|