C12H14N4O5S2 — CID 155662433
[(4R)-5-oxo-4-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)pyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 155662433) has the molecular formula C12H14N4O5S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is [(4R)-5-oxo-4-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)pyrrolidin-2-yl]methyl methanesulfonate.
| Compound Name | [(4R)-5-oxo-4-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)pyrrolidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 155662433 |
| Molecular Formula | C12H14N4O5S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [(4R)-5-oxo-4-(3-oxo-4H-pyrazino[2,3-b][1,4]thiazin-6-yl)pyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1C[C@H](c2cnc3c(n2)NC(=O)CS3)C(=O)N1 |
| InChI | InChI=1S/C12H14N4O5S2/c1-23(19,20)21-4-6-2-7(11(18)14-6)8-3-13-12-10(15-8)16-9(17)5-22-12/h3,6-7H,2,4-5H2,1H3,(H,14,18)(H,15,16,17)/t6?,7-/m1/s1 |
| InChIKey | OBTQXVAGNFDWPP-COBSHVIPSA-N |
| XLogP | -0.53 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|