C17H21O2P — CID 155662806
3,3-bis(4-methylphenoxy)propylphosphane (PubChem CID 155662806) has the molecular formula C17H21O2P and a molecular weight of 288.33 g/mol. Its IUPAC name is 3,3-bis(4-methylphenoxy)propylphosphane.
| Compound Name | 3,3-bis(4-methylphenoxy)propylphosphane |
|---|---|
| PubChem CID | 155662806 |
| Molecular Formula | C17H21O2P |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3,3-bis(4-methylphenoxy)propylphosphane |
| SMILES | Cc1ccc(OC(CCP)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H21O2P/c1-13-3-7-15(8-4-13)18-17(11-12-20)19-16-9-5-14(2)6-10-16/h3-10,17H,11-12,20H2,1-2H3 |
| InChIKey | VTDCWZUYTPOYQH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|