C19H13BrN2O — CID 155663132
7-methyl-3-aza-13-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaen-20-one bromide (PubChem CID 155663132) has the molecular formula C19H13BrN2O and a molecular weight of 365.23 g/mol. Its IUPAC name is 7-methyl-3-aza-13-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaen-20-one bromide.
| Compound Name | 7-methyl-3-aza-13-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaen-20-one bromide |
|---|---|
| PubChem CID | 155663132 |
| Molecular Formula | C19H13BrN2O |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 7-methyl-3-aza-13-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaen-20-one bromide |
| SMILES | Cc1ccc2[nH]c3c4[n+](ccc3c2c1)-c1ccccc1C4=O.[Br-] |
| InChI | InChI=1S/C19H12N2O.BrH/c1-11-6-7-15-14(10-11)12-8-9-21-16-5-3-2-4-13(16)19(22)18(21)17(12)20-15;/h2-10H,1H3;1H |
| InChIKey | BLHZNNPOBAIPAQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|