C18H33ClN4O2Si — CID 155663677
[(1R,2S,4R)-4-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methanol (PubChem CID 155663677) has the molecular formula C18H33ClN4O2Si and a molecular weight of 401.03 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methanol.
| Compound Name | [(1R,2S,4R)-4-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methanol |
|---|---|
| PubChem CID | 155663677 |
| Molecular Formula | C18H33ClN4O2Si |
| Molecular Weight | 401.03 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(1R,2S,4R)-4-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methanol |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](Nc2ncnc(Cl)n2)C[C@@H]1CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H33ClN4O2Si/c1-11(2)26(12(3)4,13(5)6)25-16-8-15(7-14(16)9-24)22-18-21-10-20-17(19)23-18/h10-16,24H,7-9H2,1-6H3,(H,20,21,22,23)/t14-,15-,16+/m1/s1 |
| InChIKey | ZXIGVZOWGQRRSZ-OAGGEKHMSA-N |
| XLogP | 4.27 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.03 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|