C9H11Cl2FN4O2 — CID 155663678
(1R,2S,3R,5R)-3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-fluoro-5-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 155663678) has the molecular formula C9H11Cl2FN4O2 and a molecular weight of 297.12 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-fluoro-5-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,3R,5R)-3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-fluoro-5-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 155663678 |
| Molecular Formula | C9H11Cl2FN4O2 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-fluoro-5-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | OC[C@H]1C[C@@H](Nc2nc(Cl)nc(Cl)n2)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H11Cl2FN4O2/c10-7-14-8(11)16-9(15-7)13-4-1-3(2-17)6(18)5(4)12/h3-6,17-18H,1-2H2,(H,13,14,15,16)/t3-,4-,5+,6-/m1/s1 |
| InChIKey | JTVKFESYMIFUQY-ARQDHWQXSA-N |
| XLogP | 0.67 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |