C15H13FN6O2 — CID 155663788
4-[(4-fluorophenyl)methoxy]-N'-hydroxy-3-(tetrazol-1-yl)benzenecarboximidamide (PubChem CID 155663788) has the molecular formula C15H13FN6O2 and a molecular weight of 328.31 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methoxy]-N'-hydroxy-3-(tetrazol-1-yl)benzenecarboximidamide.
| Compound Name | 4-[(4-fluorophenyl)methoxy]-N'-hydroxy-3-(tetrazol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 155663788 |
| Molecular Formula | C15H13FN6O2 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[(4-fluorophenyl)methoxy]-N'-hydroxy-3-(tetrazol-1-yl)benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCc2ccc(F)cc2)c(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H13FN6O2/c16-12-4-1-10(2-5-12)8-24-14-6-3-11(15(17)19-23)7-13(14)22-9-18-20-21-22/h1-7,9,23H,8H2,(H2,17,19) |
| InChIKey | VLDQJEPRHWOJAC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|